C22H21BO2 — CID 141350757
[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]boronic acid (PubChem CID 141350757) has the molecular formula C22H21BO2 and a molecular weight of 328.22 g/mol. Its IUPAC name is [4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]boronic acid.
| Compound Name | [4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 141350757 |
| Molecular Formula | C22H21BO2 |
| Molecular Weight | 328.22 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]boronic acid |
| SMILES | Cc1ccc(C(=Cc2ccc(B(O)O)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H21BO2/c1-16-3-9-19(10-4-16)22(20-11-5-17(2)6-12-20)15-18-7-13-21(14-8-18)23(24)25/h3-15,24-25H,1-2H3 |
| InChIKey | JRXABGAIYKPAKP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.22 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|