C78H68 — CID 163829101
1-[(Z)-2-[3,5-bis[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]-3,5-bis[2,2-bis(4-methylphenyl)ethenyl]benzene (PubChem CID 163829101) has the molecular formula C78H68 and a molecular weight of 1005.40 g/mol. Its IUPAC name is 1-[(Z)-2-[3,5-bis[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]-3,5-bis[2,2-bis(4-methylphenyl)ethenyl]benzene.
| Compound Name | 1-[(Z)-2-[3,5-bis[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]-3,5-bis[2,2-bis(4-methylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 163829101 |
| Molecular Formula | C78H68 |
| Molecular Weight | 1005.40 g/mol |
| Exact Mass | 1004.53 |
| IUPAC Name | 1-[(Z)-2-[3,5-bis[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]-3,5-bis[2,2-bis(4-methylphenyl)ethenyl]benzene |
| SMILES | Cc1ccc(C(=Cc2cc(C=C(c3ccc(C)cc3)c3ccc(C)cc3)cc(/C=C\c3cc(C=C(c4ccc(C)cc4)c4ccc(C)cc4)cc(C=C(c4ccc(C)cc4)c4ccc(C)cc4)c3)c2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C78H68/c1-53-9-27-67(28-10-53)75(68-29-11-54(2)12-30-68)49-63-43-61(44-64(47-63)50-76(69-31-13-55(3)14-32-69)70-33-15-56(4)16-34-70)25-26-62-45-65(51-77(71-35-17-57(5)18-36-71)72-37-19-58(6)20-38-72)48-66(46-62)52-78(73-39-21-59(7)22-40-73)74-41-23-60(8)24-42-74/h9-52H,1-8H3/b26-25- |
| InChIKey | OCDFVRDGLLITEK-QPLCGJKRSA-N |
| XLogP | 20.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.40 |
| LogP ≤ 5 | 20.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|