C58H48 — CID 147683852
1,3-bis[(Z)-2-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]naphthalene (PubChem CID 147683852) has the molecular formula C58H48 and a molecular weight of 745.02 g/mol. Its IUPAC name is 1,3-bis[(Z)-2-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]naphthalene.
| Compound Name | 1,3-bis[(Z)-2-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 147683852 |
| Molecular Formula | C58H48 |
| Molecular Weight | 745.02 g/mol |
| Exact Mass | 744.38 |
| IUPAC Name | 1,3-bis[(Z)-2-[4-[2,2-bis(4-methylphenyl)ethenyl]phenyl]ethenyl]naphthalene |
| SMILES | Cc1ccc(C(=Cc2ccc(/C=C\c3cc(/C=C\c4ccc(C=C(c5ccc(C)cc5)c5ccc(C)cc5)cc4)c4ccccc4c3)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C58H48/c1-41-9-28-50(29-10-41)57(51-30-11-42(2)12-31-51)39-47-22-17-45(18-23-47)21-26-49-37-54-7-5-6-8-56(54)55(38-49)36-27-46-19-24-48(25-20-46)40-58(52-32-13-43(3)14-33-52)53-34-15-44(4)16-35-53/h5-40H,1-4H3/b26-21-,36-27- |
| InChIKey | GPQGYJYXOUBFNU-FVUVSXIISA-N |
| XLogP | 15.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.02 |
| LogP ≤ 5 | 15.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|