C54H46 — CID 20678110
1,4-bis[(E)-2-[4-(2,2-diphenylethenyl)phenyl]ethenyl]-2,3,5,6-tetramethylbenzene (PubChem CID 20678110) has the molecular formula C54H46 and a molecular weight of 694.96 g/mol. Its IUPAC name is 1,4-bis[(E)-2-[4-(2,2-diphenylethenyl)phenyl]ethenyl]-2,3,5,6-tetramethylbenzene.
| Compound Name | 1,4-bis[(E)-2-[4-(2,2-diphenylethenyl)phenyl]ethenyl]-2,3,5,6-tetramethylbenzene |
|---|---|
| PubChem CID | 20678110 |
| Molecular Formula | C54H46 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | 1,4-bis[(E)-2-[4-(2,2-diphenylethenyl)phenyl]ethenyl]-2,3,5,6-tetramethylbenzene |
| SMILES | Cc1c(C)c(/C=C/c2ccc(C=C(c3ccccc3)c3ccccc3)cc2)c(C)c(C)c1/C=C/c1ccc(C=C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H46/c1-39-40(2)52(36-34-44-27-31-46(32-28-44)38-54(49-21-13-7-14-22-49)50-23-15-8-16-24-50)42(4)41(3)51(39)35-33-43-25-29-45(30-26-43)37-53(47-17-9-5-10-18-47)48-19-11-6-12-20-48/h5-38H,1-4H3/b35-33+,36-34+ |
| InChIKey | WYSLTFSHOIOLGE-LBYUQGKWSA-N |
| XLogP | 14.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 14.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|