C19H22O — CID 158435639
[2,3,5,6-tetramethyl-4-[(E)-2-phenylethenyl]phenyl]methanol (PubChem CID 158435639) has the molecular formula C19H22O and a molecular weight of 266.38 g/mol. Its IUPAC name is [2,3,5,6-tetramethyl-4-[(E)-2-phenylethenyl]phenyl]methanol.
| Compound Name | [2,3,5,6-tetramethyl-4-[(E)-2-phenylethenyl]phenyl]methanol |
|---|---|
| PubChem CID | 158435639 |
| Molecular Formula | C19H22O |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [2,3,5,6-tetramethyl-4-[(E)-2-phenylethenyl]phenyl]methanol |
| SMILES | Cc1c(C)c(CO)c(C)c(C)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C19H22O/c1-13-15(3)19(12-20)16(4)14(2)18(13)11-10-17-8-6-5-7-9-17/h5-11,20H,12H2,1-4H3/b11-10+ |
| InChIKey | GGADVCUTIZYXAQ-ZHACJKMWSA-N |
| XLogP | 4.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|