About pentan-1-ol;(E)-stilbene
pentan-1-ol;(E)-stilbene (PubChem CID 172553874) has the molecular formula C19H24O
and a molecular weight of 268.40 g/mol. Its IUPAC name is pentan-1-ol;(E)-stilbene.
Molecular Properties
| Compound Name | pentan-1-ol;(E)-stilbene |
| PubChem CID | 172553874 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | pentan-1-ol;(E)-stilbene |
| SMILES | C(=C/c1ccccc1)\c1ccccc1.CCCCCO |
| InChI | InChI=1S/C14H12.C5H12O/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-3-4-5-6/h1-12H;6H,2-5H2,1H3/b12-11+; |
| InChIKey | PTRSLASGQOJAQO-CALJPSDSSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze pentan-1-ol;(E)-stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-1-ol;(E)-stilbene?
The IUPAC name of pentan-1-ol;(E)-stilbene (CID 172553874) is pentan-1-ol;(E)-stilbene.
What is the SMILES notation for pentan-1-ol;(E)-stilbene?
The canonical SMILES for pentan-1-ol;(E)-stilbene is C(=C/c1ccccc1)\c1ccccc1.CCCCCO.
What is the InChIKey of pentan-1-ol;(E)-stilbene?
The InChIKey is PTRSLASGQOJAQO-CALJPSDSSA-N. The full InChI is InChI=1S/C14H12.C5H12O/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-2-3-4-5-6/h1-12H;6H,2-5H2,1H3/b12-11+;.
What are the key properties of pentan-1-ol;(E)-stilbene?
pentan-1-ol;(E)-stilbene has a molecular weight of 268.40 g/mol, XLogP of 5.03, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-1-ol;(E)-stilbene is sourced from PubChem (CID 172553874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).