About hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene
hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene (PubChem CID 175128455) has the molecular formula C26H36O2
and a molecular weight of 380.57 g/mol. Its IUPAC name is hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene.
Molecular Properties
| Compound Name | hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene |
| PubChem CID | 175128455 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene |
| SMILES | CCC(=Cc1ccccc1)OC(=Cc1ccccc1)CC.CCCCCCO |
| InChI | InChI=1S/C20H22O.C6H14O/c1-3-19(15-17-11-7-5-8-12-17)21-20(4-2)16-18-13-9-6-10-14-18;1-2-3-4-5-6-7/h5-16H,3-4H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | WLHGAKWSCFXSQF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene?
The IUPAC name of hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene (CID 175128455) is hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene.
What is the SMILES notation for hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene?
The canonical SMILES for hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene is CCC(=Cc1ccccc1)OC(=Cc1ccccc1)CC.CCCCCCO.
What is the InChIKey of hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene?
The InChIKey is WLHGAKWSCFXSQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22O.C6H14O/c1-3-19(15-17-11-7-5-8-12-17)21-20(4-2)16-18-13-9-6-10-14-18;1-2-3-4-5-6-7/h5-16H,3-4H2,1-2H3;7H,2-6H2,1H3.
What are the key properties of hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene?
hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene has a molecular weight of 380.57 g/mol, XLogP of 7.46, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-1-ol;2-(1-phenylbut-1-en-2-yloxy)but-1-enylbenzene is sourced from PubChem (CID 175128455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).