About CID 173126547
CID 173126547 (PubChem CID 173126547) has the molecular formula C20H16Sb
and a molecular weight of 378.11 g/mol.
Molecular Properties
| Compound Name | CID 173126547 |
| PubChem CID | 173126547 |
| Molecular Formula | C20H16Sb |
| Molecular Weight | 378.11 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | — |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.[Sb] |
| InChI | InChI=1S/C20H16.Sb/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-16H; |
| InChIKey | TYLJDUHYONPOSB-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.11 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze CID 173126547 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173126547?
The IUPAC name of CID 173126547 (CID 173126547) is not available.
What is the SMILES notation for CID 173126547?
The canonical SMILES for CID 173126547 is C(=C(c1ccccc1)c1ccccc1)c1ccccc1.[Sb].
What is the InChIKey of CID 173126547?
The InChIKey is TYLJDUHYONPOSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16.Sb/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;/h1-16H;.
What are the key properties of CID 173126547?
CID 173126547 has a molecular weight of 378.11 g/mol, XLogP of 4.89, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173126547 is sourced from PubChem (CID 173126547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).