C32H24S — CID 12965056
2,5-bis[(E)-1,2-diphenylethenyl]thiophene (PubChem CID 12965056) has the molecular formula C32H24S and a molecular weight of 440.61 g/mol. Its IUPAC name is 2,5-bis[(E)-1,2-diphenylethenyl]thiophene.
| Compound Name | 2,5-bis[(E)-1,2-diphenylethenyl]thiophene |
|---|---|
| PubChem CID | 12965056 |
| Molecular Formula | C32H24S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2,5-bis[(E)-1,2-diphenylethenyl]thiophene |
| SMILES | C(=C(\c1ccccc1)c1ccc(/C(=C/c2ccccc2)c2ccccc2)s1)\c1ccccc1 |
| InChI | InChI=1S/C32H24S/c1-5-13-25(14-6-1)23-29(27-17-9-3-10-18-27)31-21-22-32(33-31)30(28-19-11-4-12-20-28)24-26-15-7-2-8-16-26/h1-24H/b29-23+,30-24+ |
| InChIKey | GZRQXIIZOGVEMZ-HCTXVGCHSA-N |
| XLogP | 8.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|