C20H15Cl — CID 58695106
1-chloro-4-(1,2-diphenylethenyl)benzene (PubChem CID 58695106) has the molecular formula C20H15Cl and a molecular weight of 290.79 g/mol. Its IUPAC name is 1-chloro-4-(1,2-diphenylethenyl)benzene.
| Compound Name | 1-chloro-4-(1,2-diphenylethenyl)benzene |
|---|---|
| PubChem CID | 58695106 |
| Molecular Formula | C20H15Cl |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-chloro-4-(1,2-diphenylethenyl)benzene |
| SMILES | Clc1ccc(C(=Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H15Cl/c21-19-13-11-18(12-14-19)20(17-9-5-2-6-10-17)15-16-7-3-1-4-8-16/h1-15H |
| InChIKey | PPRWZQWEXASZAT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|