C27H24O — CID 159908422
1,2-diphenylethenylbenzene;2-methylphenol (PubChem CID 159908422) has the molecular formula C27H24O and a molecular weight of 364.49 g/mol. Its IUPAC name is 1,2-diphenylethenylbenzene;2-methylphenol.
| Compound Name | 1,2-diphenylethenylbenzene;2-methylphenol |
|---|---|
| PubChem CID | 159908422 |
| Molecular Formula | C27H24O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 1,2-diphenylethenylbenzene;2-methylphenol |
| SMILES | C(=C(c1ccccc1)c1ccccc1)c1ccccc1.Cc1ccccc1O |
| InChI | InChI=1S/C20H16.C7H8O/c1-4-10-17(11-5-1)16-20(18-12-6-2-7-13-18)19-14-8-3-9-15-19;1-6-4-2-3-5-7(6)8/h1-16H;2-5,8H,1H3 |
| InChIKey | NWWGSSGKPNFMJY-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|