C23H22 — CID 12611498
2-[(E)-1,2-diphenylethenyl]-1,3,5-trimethylbenzene (PubChem CID 12611498) has the molecular formula C23H22 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(E)-1,2-diphenylethenyl]-1,3,5-trimethylbenzene.
| Compound Name | 2-[(E)-1,2-diphenylethenyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 12611498 |
| Molecular Formula | C23H22 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-[(E)-1,2-diphenylethenyl]-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(/C(=C/c2ccccc2)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H22/c1-17-14-18(2)23(19(3)15-17)22(21-12-8-5-9-13-21)16-20-10-6-4-7-11-20/h4-16H,1-3H3/b22-16+ |
| InChIKey | AQEXIFVGJAWYRR-CJLVFECKSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|