C66H64 — CID 21365156
2,3-bis[(E)-2-[4-[2,2-bis(2,4,6-trimethylphenyl)ethenyl]phenyl]ethenyl]naphthalene (PubChem CID 21365156) has the molecular formula C66H64 and a molecular weight of 857.24 g/mol. Its IUPAC name is 2,3-bis[(E)-2-[4-[2,2-bis(2,4,6-trimethylphenyl)ethenyl]phenyl]ethenyl]naphthalene.
| Compound Name | 2,3-bis[(E)-2-[4-[2,2-bis(2,4,6-trimethylphenyl)ethenyl]phenyl]ethenyl]naphthalene |
|---|---|
| PubChem CID | 21365156 |
| Molecular Formula | C66H64 |
| Molecular Weight | 857.24 g/mol |
| Exact Mass | 856.50 |
| IUPAC Name | 2,3-bis[(E)-2-[4-[2,2-bis(2,4,6-trimethylphenyl)ethenyl]phenyl]ethenyl]naphthalene |
| SMILES | Cc1cc(C)c(C(=Cc2ccc(/C=C/c3cc4ccccc4cc3/C=C/c3ccc(C=C(c4c(C)cc(C)cc4C)c4c(C)cc(C)cc4C)cc3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C66H64/c1-41-29-45(5)63(46(6)30-41)61(64-47(7)31-42(2)32-48(64)8)37-55-21-17-53(18-22-55)25-27-59-39-57-15-13-14-16-58(57)40-60(59)28-26-54-19-23-56(24-20-54)38-62(65-49(9)33-43(3)34-50(65)10)66-51(11)35-44(4)36-52(66)12/h13-40H,1-12H3/b27-25+,28-26+ |
| InChIKey | YWLNVUFZNQRSQZ-NBHCHVEOSA-N |
| XLogP | 18.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.24 |
| LogP ≤ 5 | 18.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|