C32H32 — CID 21365152
2,3-bis[(E)-2-(3,4,5-trimethylphenyl)ethenyl]naphthalene (PubChem CID 21365152) has the molecular formula C32H32 and a molecular weight of 416.61 g/mol. Its IUPAC name is 2,3-bis[(E)-2-(3,4,5-trimethylphenyl)ethenyl]naphthalene.
| Compound Name | 2,3-bis[(E)-2-(3,4,5-trimethylphenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 21365152 |
| Molecular Formula | C32H32 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | 2,3-bis[(E)-2-(3,4,5-trimethylphenyl)ethenyl]naphthalene |
| SMILES | Cc1cc(/C=C/c2cc3ccccc3cc2/C=C/c2cc(C)c(C)c(C)c2)cc(C)c1C |
| InChI | InChI=1S/C32H32/c1-21-15-27(16-22(2)25(21)5)11-13-31-19-29-9-7-8-10-30(29)20-32(31)14-12-28-17-23(3)26(6)24(4)18-28/h7-20H,1-6H3/b13-11+,14-12+ |
| InChIKey | YBGSDBKTOLJCDN-PHEQNACWSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|