C23H20O — CID 6071425
2-methyl-4,6-bis[(E)-2-phenylethenyl]phenol (PubChem CID 6071425) has the molecular formula C23H20O and a molecular weight of 312.41 g/mol. Its IUPAC name is 2-methyl-4,6-bis[(E)-2-phenylethenyl]phenol.
| Compound Name | 2-methyl-4,6-bis[(E)-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 6071425 |
| Molecular Formula | C23H20O |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-methyl-4,6-bis[(E)-2-phenylethenyl]phenol |
| SMILES | Cc1cc(/C=C/c2ccccc2)cc(/C=C/c2ccccc2)c1O |
| InChI | InChI=1S/C23H20O/c1-18-16-21(13-12-19-8-4-2-5-9-19)17-22(23(18)24)15-14-20-10-6-3-7-11-20/h2-17,24H,1H3/b13-12+,15-14+ |
| InChIKey | WYBHTQRLNGXEGI-SQIWNDBBSA-N |
| XLogP | 6.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|