About 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol
3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol (PubChem CID 59639128) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol.
Molecular Properties
| Compound Name | 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol |
| PubChem CID | 59639128 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol |
| SMILES | Cc1cc(O)c(C/C=C/c2ccccc2)c(C)c1O |
| InChI | InChI=1S/C17H18O2/c1-12-11-16(18)15(13(2)17(12)19)10-6-9-14-7-4-3-5-8-14/h3-9,11,18-19H,10H2,1-2H3/b9-6+ |
| InChIKey | FISFUNZISWKKQZ-RMKNXTFCSA-N |
| XLogP | 3.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol?
The IUPAC name of 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol (CID 59639128) is 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol.
What is the SMILES notation for 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol?
The canonical SMILES for 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol is Cc1cc(O)c(C/C=C/c2ccccc2)c(C)c1O.
What is the InChIKey of 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol?
The InChIKey is FISFUNZISWKKQZ-RMKNXTFCSA-N. The full InChI is InChI=1S/C17H18O2/c1-12-11-16(18)15(13(2)17(12)19)10-6-9-14-7-4-3-5-8-14/h3-9,11,18-19H,10H2,1-2H3/b9-6+.
What are the key properties of 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol?
3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol has a molecular weight of 254.33 g/mol, XLogP of 3.97, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2-[(E)-3-phenylprop-2-enyl]benzene-1,4-diol is sourced from PubChem (CID 59639128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).