C15H14O2 — CID 54349288
3-(3-phenylprop-2-enyl)benzene-1,2-diol (PubChem CID 54349288) has the molecular formula C15H14O2 and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-(3-phenylprop-2-enyl)benzene-1,2-diol.
| Compound Name | 3-(3-phenylprop-2-enyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 54349288 |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 3-(3-phenylprop-2-enyl)benzene-1,2-diol |
| SMILES | Oc1cccc(CC=Cc2ccccc2)c1O |
| InChI | InChI=1S/C15H14O2/c16-14-11-5-10-13(15(14)17)9-4-8-12-6-2-1-3-7-12/h1-8,10-11,16-17H,9H2 |
| InChIKey | UEOJFRASCSXHBM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|