C24H24O — CID 162361498
2-[(2E,4E)-4-ethenylhepta-2,4,6-trienyl]-6-[(E)-3-phenylprop-2-enyl]phenol (PubChem CID 162361498) has the molecular formula C24H24O and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[(2E,4E)-4-ethenylhepta-2,4,6-trienyl]-6-[(E)-3-phenylprop-2-enyl]phenol.
| Compound Name | 2-[(2E,4E)-4-ethenylhepta-2,4,6-trienyl]-6-[(E)-3-phenylprop-2-enyl]phenol |
|---|---|
| PubChem CID | 162361498 |
| Molecular Formula | C24H24O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 2-[(2E,4E)-4-ethenylhepta-2,4,6-trienyl]-6-[(E)-3-phenylprop-2-enyl]phenol |
| SMILES | C=C/C=C(C=C)/C=C/Cc1cccc(C/C=C/c2ccccc2)c1O |
| InChI | InChI=1S/C24H24O/c1-3-11-20(4-2)14-8-16-22-18-10-19-23(24(22)25)17-9-15-21-12-6-5-7-13-21/h3-15,18-19,25H,1-2,16-17H2/b14-8+,15-9+,20-11+ |
| InChIKey | FUPQDXIOYZWSLQ-YFGLBZLWSA-N |
| XLogP | 6.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|