C15H16 — CID 142164883
1-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-methylbenzene (PubChem CID 142164883) has the molecular formula C15H16 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-methylbenzene.
| Compound Name | 1-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 142164883 |
| Molecular Formula | C15H16 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 1-[(1E,3E)-3-ethenylhexa-1,3,5-trienyl]-4-methylbenzene |
| SMILES | C=C/C=C(C=C)/C=C/c1ccc(C)cc1 |
| InChI | InChI=1S/C15H16/c1-4-6-14(5-2)11-12-15-9-7-13(3)8-10-15/h4-12H,1-2H2,3H3/b12-11+,14-6+ |
| InChIKey | WUZGUFABMWMVHT-QTDCPVIDSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|