C14H16 — CID 142964933
1-methyl-4-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]benzene (PubChem CID 142964933) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-methyl-4-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]benzene.
| Compound Name | 1-methyl-4-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]benzene |
|---|---|
| PubChem CID | 142964933 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-methyl-4-[(1E,3Z)-4-methylhexa-1,3,5-trienyl]benzene |
| SMILES | C=C/C(C)=C\C=C\c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16/c1-4-12(2)6-5-7-14-10-8-13(3)9-11-14/h4-11H,1H2,2-3H3/b7-5+,12-6- |
| InChIKey | VTNPAFJMNJIUMP-AJBKOCBKSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|