C23H30 — CID 143762679
(3Z,5Z)-3-methylhepta-1,3,5-triene;toluene;1,4-xylene (PubChem CID 143762679) has the molecular formula C23H30 and a molecular weight of 306.49 g/mol. Its IUPAC name is (3Z,5Z)-3-methylhepta-1,3,5-triene;toluene;1,4-xylene.
| Compound Name | (3Z,5Z)-3-methylhepta-1,3,5-triene;toluene;1,4-xylene |
|---|---|
| PubChem CID | 143762679 |
| Molecular Formula | C23H30 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | (3Z,5Z)-3-methylhepta-1,3,5-triene;toluene;1,4-xylene |
| SMILES | C=C/C(C)=C\C=C/C.Cc1ccc(C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C8H10.C8H12.C7H8/c1-7-3-5-8(2)6-4-7;1-4-6-7-8(3)5-2;1-7-5-3-2-4-6-7/h3-6H,1-2H3;4-7H,2H2,1,3H3;2-6H,1H3/b;6-4-,8-7-; |
| InChIKey | MYINWKIXDJSYNF-FOFCQDJRSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|