C17H20 — CID 142077289
1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene (PubChem CID 142077289) has the molecular formula C17H20 and a molecular weight of 224.35 g/mol. Its IUPAC name is 1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene.
| Compound Name | 1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene |
|---|---|
| PubChem CID | 142077289 |
| Molecular Formula | C17H20 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 1-[(1Z,4Z,6Z)-4-ethenylocta-1,4,6-trienyl]-3-methylbenzene |
| SMILES | C=C/C(=C\C=C/C)C/C=C\c1cccc(C)c1 |
| InChI | InChI=1S/C17H20/c1-4-6-10-16(5-2)11-8-13-17-12-7-9-15(3)14-17/h4-10,12-14H,2,11H2,1,3H3/b6-4-,13-8-,16-10+ |
| InChIKey | PYIOEPXLXAEJKK-NGLCHKOTSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|