C14H17N — CID 144905382
N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-methylaniline (PubChem CID 144905382) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-methylaniline.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-methylaniline |
|---|---|
| PubChem CID | 144905382 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-3-methylaniline |
| SMILES | C=C/C(=C\C=C/C)Nc1cccc(C)c1 |
| InChI | InChI=1S/C14H17N/c1-4-6-9-13(5-2)15-14-10-7-8-12(3)11-14/h4-11,15H,2H2,1,3H3/b6-4-,13-9+ |
| InChIKey | WSJMPQDRJXMBKZ-WZSXDBPKSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|