C11H14N2S — CID 3492074
1-(3-methylphenyl)-3-prop-2-enylthiourea (PubChem CID 3492074) has the molecular formula C11H14N2S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(3-methylphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3492074 |
| Molecular Formula | C11H14N2S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-(3-methylphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cccc(C)c1 |
| InChI | InChI=1S/C11H14N2S/c1-3-7-12-11(14)13-10-6-4-5-9(2)8-10/h3-6,8H,1,7H2,2H3,(H2,12,13,14) |
| InChIKey | UPUCUDIBNAWHBA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|