C12H16N2S — CID 5200101
1-(2,6-dimethylphenyl)-3-prop-2-enylthiourea (PubChem CID 5200101) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(2,6-dimethylphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 5200101 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1c(C)cccc1C |
| InChI | InChI=1S/C12H16N2S/c1-4-8-13-12(15)14-11-9(2)6-5-7-10(11)3/h4-7H,1,8H2,2-3H3,(H2,13,14,15) |
| InChIKey | YBCMPOZPNYWSPZ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|