C17H18N2S — CID 78357849
1-(4-benzylphenyl)-3-prop-2-enylthiourea (PubChem CID 78357849) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is 1-(4-benzylphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(4-benzylphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 78357849 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-(4-benzylphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C17H18N2S/c1-2-12-18-17(20)19-16-10-8-15(9-11-16)13-14-6-4-3-5-7-14/h2-11H,1,12-13H2,(H2,18,19,20) |
| InChIKey | PVRRUBGMINKKCW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|