C14H16N3O3S- — CID 2143475
4-oxo-4-[4-(prop-2-enylcarbamothioylamino)anilino]butanoate (PubChem CID 2143475) has the molecular formula C14H16N3O3S- and a molecular weight of 306.37 g/mol. Its IUPAC name is 4-oxo-4-[4-(prop-2-enylcarbamothioylamino)anilino]butanoate.
| Compound Name | 4-oxo-4-[4-(prop-2-enylcarbamothioylamino)anilino]butanoate |
|---|---|
| PubChem CID | 2143475 |
| Molecular Formula | C14H16N3O3S- |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 4-oxo-4-[4-(prop-2-enylcarbamothioylamino)anilino]butanoate |
| SMILES | C=CCNC(=S)Nc1ccc(NC(=O)CCC(=O)[O-])cc1 |
| InChI | InChI=1S/C14H17N3O3S/c1-2-9-15-14(21)17-11-5-3-10(4-6-11)16-12(18)7-8-13(19)20/h2-6H,1,7-9H2,(H,16,18)(H,19,20)(H2,15,17,21)/p-1 |
| InChIKey | KPLRPRCCYIAGKT-UHFFFAOYSA-M |
| XLogP | 0.63 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|