C20H20N2O2 — CID 12519604
N,N'-bis(4-ethenylphenyl)butanediamide (PubChem CID 12519604) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is N,N'-bis(4-ethenylphenyl)butanediamide.
| Compound Name | N,N'-bis(4-ethenylphenyl)butanediamide |
|---|---|
| PubChem CID | 12519604 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | N,N'-bis(4-ethenylphenyl)butanediamide |
| SMILES | C=Cc1ccc(NC(=O)CCC(=O)Nc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C20H20N2O2/c1-3-15-5-9-17(10-6-15)21-19(23)13-14-20(24)22-18-11-7-16(4-2)8-12-18/h3-12H,1-2,13-14H2,(H,21,23)(H,22,24) |
| InChIKey | AGILSXWYQSZWSU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |