C12H15NO4 — CID 163784591
2-(2,2-dihydroxyethoxy)-N-(4-ethenylphenyl)acetamide (PubChem CID 163784591) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-(2,2-dihydroxyethoxy)-N-(4-ethenylphenyl)acetamide.
| Compound Name | 2-(2,2-dihydroxyethoxy)-N-(4-ethenylphenyl)acetamide |
|---|---|
| PubChem CID | 163784591 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2-(2,2-dihydroxyethoxy)-N-(4-ethenylphenyl)acetamide |
| SMILES | C=Cc1ccc(NC(=O)COCC(O)O)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-2-9-3-5-10(6-4-9)13-11(14)7-17-8-12(15)16/h2-6,12,15-16H,1,7-8H2,(H,13,14) |
| InChIKey | MRLCKQNWUMZVIJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|