C20H22N4OS2 — CID 8620453
1-prop-2-enyl-3-[4-[4-(prop-2-enylcarbamothioylamino)phenoxy]phenyl]thiourea (PubChem CID 8620453) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 1-prop-2-enyl-3-[4-[4-(prop-2-enylcarbamothioylamino)phenoxy]phenyl]thiourea.
| Compound Name | 1-prop-2-enyl-3-[4-[4-(prop-2-enylcarbamothioylamino)phenoxy]phenyl]thiourea |
|---|---|
| PubChem CID | 8620453 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 1-prop-2-enyl-3-[4-[4-(prop-2-enylcarbamothioylamino)phenoxy]phenyl]thiourea |
| SMILES | C=CCNC(=S)Nc1ccc(Oc2ccc(NC(=S)NCC=C)cc2)cc1 |
| InChI | InChI=1S/C20H22N4OS2/c1-3-13-21-19(26)23-15-5-9-17(10-6-15)25-18-11-7-16(8-12-18)24-20(27)22-14-4-2/h3-12H,1-2,13-14H2,(H2,21,23,26)(H2,22,24,27) |
| InChIKey | NAPDHWOBEGXIBU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 57.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|