C11H13FN2S — CID 8624786
1-(2-fluoro-5-methylphenyl)-3-prop-2-enylthiourea (PubChem CID 8624786) has the molecular formula C11H13FN2S and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)-3-prop-2-enylthiourea.
| Compound Name | 1-(2-fluoro-5-methylphenyl)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8624786 |
| Molecular Formula | C11H13FN2S |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cc(C)ccc1F |
| InChI | InChI=1S/C11H13FN2S/c1-3-6-13-11(15)14-10-7-8(2)4-5-9(10)12/h3-5,7H,1,6H2,2H3,(H2,13,14,15) |
| InChIKey | AOYVPMVXJPBHSQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|