C13H17FN2OS — CID 19687244
1-(2-fluoro-5-methylphenyl)-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 19687244) has the molecular formula C13H17FN2OS and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-(2-fluoro-5-methylphenyl)-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 19687244 |
| Molecular Formula | C13H17FN2OS |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(F)c(NC(=S)NCC2CCCO2)c1 |
| InChI | InChI=1S/C13H17FN2OS/c1-9-4-5-11(14)12(7-9)16-13(18)15-8-10-3-2-6-17-10/h4-5,7,10H,2-3,6,8H2,1H3,(H2,15,16,18) |
| InChIKey | XIUWIWWWHPQVNY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|