C13H18N2OS — CID 886428
1-(2-methylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 886428) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 1-(2-methylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-(2-methylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 886428 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 1-(2-methylphenyl)-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccccc1NC(=S)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C13H18N2OS/c1-10-5-2-3-7-12(10)15-13(17)14-9-11-6-4-8-16-11/h2-3,5,7,11H,4,6,8-9H2,1H3,(H2,14,15,17)/t11-/m1/s1 |
| InChIKey | XAPOGQPKHAGOPY-LLVKDONJSA-N |
| XLogP | 2.46 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|