C11H15N3S — CID 8668733
1-(3-methylanilino)-3-prop-2-enylthiourea (PubChem CID 8668733) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-(3-methylanilino)-3-prop-2-enylthiourea.
| Compound Name | 1-(3-methylanilino)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 8668733 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-(3-methylanilino)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNc1cccc(C)c1 |
| InChI | InChI=1S/C11H15N3S/c1-3-7-12-11(15)14-13-10-6-4-5-9(2)8-10/h3-6,8,13H,1,7H2,2H3,(H2,12,14,15) |
| InChIKey | LQUUTXTWIRFEQI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|