C10H12N4O2S — CID 3837380
1-(4-nitroanilino)-3-prop-2-enylthiourea (PubChem CID 3837380) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(4-nitroanilino)-3-prop-2-enylthiourea.
| Compound Name | 1-(4-nitroanilino)-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 3837380 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(4-nitroanilino)-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)NNc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H12N4O2S/c1-2-7-11-10(17)13-12-8-3-5-9(6-4-8)14(15)16/h2-6,12H,1,7H2,(H2,11,13,17) |
| InChIKey | RUBNOJFDOZNHSQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|