C17H14N6O2S — CID 11222330
1-[3-(4-nitrophenyl)pyrido[2,3-b]pyrazin-7-yl]-3-prop-2-enylthiourea (PubChem CID 11222330) has the molecular formula C17H14N6O2S and a molecular weight of 366.41 g/mol. Its IUPAC name is 1-[3-(4-nitrophenyl)pyrido[2,3-b]pyrazin-7-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-(4-nitrophenyl)pyrido[2,3-b]pyrazin-7-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 11222330 |
| Molecular Formula | C17H14N6O2S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 1-[3-(4-nitrophenyl)pyrido[2,3-b]pyrazin-7-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1cnc2nc(-c3ccc([N+](=O)[O-])cc3)cnc2c1 |
| InChI | InChI=1S/C17H14N6O2S/c1-2-7-18-17(26)21-12-8-14-16(20-9-12)22-15(10-19-14)11-3-5-13(6-4-11)23(24)25/h2-6,8-10H,1,7H2,(H2,18,21,26) |
| InChIKey | XLZHCLPNGFZKEI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|