C16H13ClN6S — CID 88994067
1-[3-(6-chloro-2-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea (PubChem CID 88994067) has the molecular formula C16H13ClN6S and a molecular weight of 356.84 g/mol. Its IUPAC name is 1-[3-(6-chloro-2-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-(6-chloro-2-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 88994067 |
| Molecular Formula | C16H13ClN6S |
| Molecular Weight | 356.84 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 1-[3-(6-chloro-2-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2ncc(-c3cccc(Cl)n3)nc2n1 |
| InChI | InChI=1S/C16H13ClN6S/c1-2-8-18-16(24)23-14-7-6-11-15(22-14)21-12(9-19-11)10-4-3-5-13(17)20-10/h2-7,9H,1,8H2,(H2,18,21,22,23,24) |
| InChIKey | NKNISNVOSTWGCY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.84 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|