C20H24N6O2S — CID 163863047
1-[3-[6-methoxy-7-(methoxymethyl)-2,7-dihydro-1H-azepin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea (PubChem CID 163863047) has the molecular formula C20H24N6O2S and a molecular weight of 412.52 g/mol. Its IUPAC name is 1-[3-[6-methoxy-7-(methoxymethyl)-2,7-dihydro-1H-azepin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea.
| Compound Name | 1-[3-[6-methoxy-7-(methoxymethyl)-2,7-dihydro-1H-azepin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
|---|---|
| PubChem CID | 163863047 |
| Molecular Formula | C20H24N6O2S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[3-[6-methoxy-7-(methoxymethyl)-2,7-dihydro-1H-azepin-4-yl]pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2ncc(C3=CCNC(COC)C(OC)=C3)nc2n1 |
| InChI | InChI=1S/C20H24N6O2S/c1-4-8-22-20(29)26-18-6-5-14-19(25-18)24-15(11-23-14)13-7-9-21-16(12-27-2)17(10-13)28-3/h4-7,10-11,16,21H,1,8-9,12H2,2-3H3,(H2,22,24,25,26,29) |
| InChIKey | PEFPJRCTUWCUFI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|