C11H11N5S — CID 86011890
1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea (PubChem CID 86011890) has the molecular formula C11H11N5S and a molecular weight of 245.31 g/mol. Its IUPAC name is 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea.
| Compound Name | 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea |
|---|---|
| PubChem CID | 86011890 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2nccnc2n1 |
| InChI | InChI=1S/C11H11N5S/c1-2-5-14-11(17)16-9-4-3-8-10(15-9)13-7-6-12-8/h2-4,6-7H,1,5H2,(H2,13,14,15,16,17) |
| InChIKey | LZPUMXULQQGOQL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|