About 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea
1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea (PubChem CID 86011890) has the molecular formula C11H11N5S
and a molecular weight of 245.31 g/mol. Its IUPAC name is 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea.
Molecular Properties
| Compound Name | 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea |
| PubChem CID | 86011890 |
| Molecular Formula | C11H11N5S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea |
| SMILES | C=CCNC(=S)Nc1ccc2nccnc2n1 |
| InChI | InChI=1S/C11H11N5S/c1-2-5-14-11(17)16-9-4-3-8-10(15-9)13-7-6-12-8/h2-4,6-7H,1,5H2,(H2,13,14,15,16,17) |
| InChIKey | LZPUMXULQQGOQL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea?
The IUPAC name of 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea (CID 86011890) is 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea.
What is the SMILES notation for 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea?
The canonical SMILES for 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea is C=CCNC(=S)Nc1ccc2nccnc2n1.
What is the InChIKey of 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea?
The InChIKey is LZPUMXULQQGOQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N5S/c1-2-5-14-11(17)16-9-4-3-8-10(15-9)13-7-6-12-8/h2-4,6-7H,1,5H2,(H2,13,14,15,16,17).
What are the key properties of 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea?
1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea has a molecular weight of 245.31 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-3-pyrido[2,3-b]pyrazin-6-ylthiourea is sourced from PubChem (CID 86011890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).