C10H10N4 — CID 78988348
N-prop-2-enylpyrido[2,3-b]pyrazin-6-amine (PubChem CID 78988348) has the molecular formula C10H10N4 and a molecular weight of 186.22 g/mol. Its IUPAC name is N-prop-2-enylpyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-prop-2-enylpyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 78988348 |
| Molecular Formula | C10H10N4 |
| Molecular Weight | 186.22 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | N-prop-2-enylpyrido[2,3-b]pyrazin-6-amine |
| SMILES | C=CCNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C10H10N4/c1-2-5-12-9-4-3-8-10(14-9)13-7-6-11-8/h2-4,6-7H,1,5H2,(H,12,13,14) |
| InChIKey | QJUPELKTXMIXHA-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|