C9H9FN4 — CID 130478045
N-(2-fluoroethyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 130478045) has the molecular formula C9H9FN4 and a molecular weight of 192.20 g/mol. Its IUPAC name is N-(2-fluoroethyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(2-fluoroethyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 130478045 |
| Molecular Formula | C9H9FN4 |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | N-(2-fluoroethyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | FCCNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C9H9FN4/c10-3-4-12-8-2-1-7-9(14-8)13-6-5-11-7/h1-2,5-6H,3-4H2,(H,12,13,14) |
| InChIKey | UWABECQFUUCPEH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |