C14H20N4O — CID 115599008
N-(3-butoxypropyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 115599008) has the molecular formula C14H20N4O and a molecular weight of 260.34 g/mol. Its IUPAC name is N-(3-butoxypropyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(3-butoxypropyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 115599008 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | N-(3-butoxypropyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CCCCOCCCNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C14H20N4O/c1-2-3-10-19-11-4-7-16-13-6-5-12-14(18-13)17-9-8-15-12/h5-6,8-9H,2-4,7,10-11H2,1H3,(H,16,17,18) |
| InChIKey | CWEXXFFRLNNHIY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|