C11H14N4S — CID 78995491
N-(3-methylsulfanylpropyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 78995491) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(3-methylsulfanylpropyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 78995491 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(3-methylsulfanylpropyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CSCCCNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C11H14N4S/c1-16-8-2-5-13-10-4-3-9-11(15-10)14-7-6-12-9/h3-4,6-7H,2,5,8H2,1H3,(H,13,14,15) |
| InChIKey | IJEUKCVHJLBTBO-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|