C13H18N4O — CID 78988496
N-(2-butoxyethyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 78988496) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(2-butoxyethyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(2-butoxyethyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 78988496 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | N-(2-butoxyethyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | CCCCOCCNc1ccc2nccnc2n1 |
| InChI | InChI=1S/C13H18N4O/c1-2-3-9-18-10-8-15-12-5-4-11-13(17-12)16-7-6-14-11/h4-7H,2-3,8-10H2,1H3,(H,15,16,17) |
| InChIKey | CCORMSXKTVXFQS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|