C17H14FN5O — CID 140514499
1-[2-(4-fluorophenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylurea (PubChem CID 140514499) has the molecular formula C17H14FN5O and a molecular weight of 323.33 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylurea.
| Compound Name | 1-[2-(4-fluorophenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylurea |
|---|---|
| PubChem CID | 140514499 |
| Molecular Formula | C17H14FN5O |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 1-[2-(4-fluorophenyl)pyrido[2,3-b]pyrazin-6-yl]-3-prop-2-enylurea |
| SMILES | C=CCNC(=O)Nc1ccc2nc(-c3ccc(F)cc3)cnc2n1 |
| InChI | InChI=1S/C17H14FN5O/c1-2-9-19-17(24)23-15-8-7-13-16(22-15)20-10-14(21-13)11-3-5-12(18)6-4-11/h2-8,10H,1,9H2,(H2,19,20,22,23,24) |
| InChIKey | CVMKZWIOMGBZHK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|