C16H16N6O2 — CID 16730610
1-ethyl-3-[3-(6-methoxy-3-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 16730610) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-ethyl-3-[3-(6-methoxy-3-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(6-methoxy-3-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 16730610 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 1-ethyl-3-[3-(6-methoxy-3-pyridinyl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3ccc(OC)nc3)nc2n1 |
| InChI | InChI=1S/C16H16N6O2/c1-3-17-16(23)22-13-6-5-11-15(21-13)20-12(9-18-11)10-4-7-14(24-2)19-8-10/h4-9H,3H2,1-2H3,(H2,17,20,21,22,23) |
| InChIKey | RNONJZWXMUBFCB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |