C16H12Cl3N5O — CID 25151141
1-ethyl-3-[3-(2,3,5-trichlorophenyl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 25151141) has the molecular formula C16H12Cl3N5O and a molecular weight of 396.67 g/mol. Its IUPAC name is 1-ethyl-3-[3-(2,3,5-trichlorophenyl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-ethyl-3-[3-(2,3,5-trichlorophenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 25151141 |
| Molecular Formula | C16H12Cl3N5O |
| Molecular Weight | 396.67 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 1-ethyl-3-[3-(2,3,5-trichlorophenyl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3cc(Cl)cc(Cl)c3Cl)nc2n1 |
| InChI | InChI=1S/C16H12Cl3N5O/c1-2-20-16(25)24-13-4-3-11-15(23-13)22-12(7-21-11)9-5-8(17)6-10(18)14(9)19/h3-7H,2H2,1H3,(H2,20,22,23,24,25) |
| InChIKey | ICRLISBYOAOWDP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|