C22H17N5O2 — CID 25159088
1-(3-dibenzofuran-4-ylpyrido[2,3-b]pyrazin-6-yl)-3-ethylurea (PubChem CID 25159088) has the molecular formula C22H17N5O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-(3-dibenzofuran-4-ylpyrido[2,3-b]pyrazin-6-yl)-3-ethylurea.
| Compound Name | 1-(3-dibenzofuran-4-ylpyrido[2,3-b]pyrazin-6-yl)-3-ethylurea |
|---|---|
| PubChem CID | 25159088 |
| Molecular Formula | C22H17N5O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 1-(3-dibenzofuran-4-ylpyrido[2,3-b]pyrazin-6-yl)-3-ethylurea |
| SMILES | CCNC(=O)Nc1ccc2ncc(-c3cccc4c3oc3ccccc34)nc2n1 |
| InChI | InChI=1S/C22H17N5O2/c1-2-23-22(28)27-19-11-10-16-21(26-19)25-17(12-24-16)15-8-5-7-14-13-6-3-4-9-18(13)29-20(14)15/h3-12H,2H2,1H3,(H2,23,25,26,27,28) |
| InChIKey | QJHYWLZZCNSDFQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |