C16H15N5O2 — CID 70814979
1-cyclopropyl-3-[3-(5-methylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea (PubChem CID 70814979) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(5-methylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea.
| Compound Name | 1-cyclopropyl-3-[3-(5-methylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
|---|---|
| PubChem CID | 70814979 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-cyclopropyl-3-[3-(5-methylfuran-2-yl)pyrido[2,3-b]pyrazin-6-yl]urea |
| SMILES | Cc1ccc(-c2cnc3ccc(NC(=O)NC4CC4)nc3n2)o1 |
| InChI | InChI=1S/C16H15N5O2/c1-9-2-6-13(23-9)12-8-17-11-5-7-14(20-15(11)19-12)21-16(22)18-10-3-4-10/h2,5-8,10H,3-4H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | LFPYPXPFHHAVMT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |