C14H13N7S — CID 88994120
1-cyclopropyl-3-[3-(1H-imidazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea (PubChem CID 88994120) has the molecular formula C14H13N7S and a molecular weight of 311.37 g/mol. Its IUPAC name is 1-cyclopropyl-3-[3-(1H-imidazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea.
| Compound Name | 1-cyclopropyl-3-[3-(1H-imidazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
|---|---|
| PubChem CID | 88994120 |
| Molecular Formula | C14H13N7S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-cyclopropyl-3-[3-(1H-imidazol-2-yl)pyrido[2,3-b]pyrazin-6-yl]thiourea |
| SMILES | S=C(Nc1ccc2ncc(-c3ncc[nH]3)nc2n1)NC1CC1 |
| InChI | InChI=1S/C14H13N7S/c22-14(18-8-1-2-8)21-11-4-3-9-13(20-11)19-10(7-17-9)12-15-5-6-16-12/h3-8H,1-2H2,(H,15,16)(H2,18,19,20,21,22) |
| InChIKey | ZAAVPNJSPFFFRD-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|